C18H21N5O4 — CID 126419096
1,3-dimethyl-5-[(R)-pyridin-4-yl-(1,4,5-trimethyl-3-oxidoimidazol-3-ium-2-yl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 126419096) has the molecular formula C18H21N5O4 and a molecular weight of 371.40 g/mol. Its IUPAC name is 1,3-dimethyl-5-[(R)-pyridin-4-yl-(1,4,5-trimethyl-3-oxidoimidazol-3-ium-2-yl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-dimethyl-5-[(R)-pyridin-4-yl-(1,4,5-trimethyl-3-oxidoimidazol-3-ium-2-yl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126419096 |
| Molecular Formula | C18H21N5O4 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 1,3-dimethyl-5-[(R)-pyridin-4-yl-(1,4,5-trimethyl-3-oxidoimidazol-3-ium-2-yl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1c(C)[n+]([O-])c([C@@H](c2ccncc2)C2C(=O)N(C)C(=O)N(C)C2=O)n1C |
| InChI | InChI=1S/C18H21N5O4/c1-10-11(2)23(27)15(20(10)3)13(12-6-8-19-9-7-12)14-16(24)21(4)18(26)22(5)17(14)25/h6-9,13-14H,1-5H3/t13-/m0/s1 |
| InChIKey | YPTVSNPSGWUFGR-ZDUSSCGKSA-N |
| XLogP | 0.47 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|