C27H25N3O5S2 — CID 126419290
N-[4-[(benzylamino)-hydroxy-oxo-λ6-sulfanylidene]cyclohexa-2,5-dien-1-ylidene]-2-[(8-methyl-2,3-dihydro-[1,4]dioxino[2,3-g]quinolin-7-yl)sulfanyl]acetamide (PubChem CID 126419290) has the molecular formula C27H25N3O5S2 and a molecular weight of 535.65 g/mol. Its IUPAC name is N-[4-[(benzylamino)-hydroxy-oxo-λ6-sulfanylidene]cyclohexa-2,5-dien-1-ylidene]-2-[(8-methyl-2,3-dihydro-[1,4]dioxino[2,3-g]quinolin-7-yl)sulfanyl]acetamide.
| Compound Name | N-[4-[(benzylamino)-hydroxy-oxo-λ6-sulfanylidene]cyclohexa-2,5-dien-1-ylidene]-2-[(8-methyl-2,3-dihydro-[1,4]dioxino[2,3-g]quinolin-7-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 126419290 |
| Molecular Formula | C27H25N3O5S2 |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.12 |
| IUPAC Name | N-[4-[(benzylamino)-hydroxy-oxo-λ6-sulfanylidene]cyclohexa-2,5-dien-1-ylidene]-2-[(8-methyl-2,3-dihydro-[1,4]dioxino[2,3-g]quinolin-7-yl)sulfanyl]acetamide |
| SMILES | Cc1cc2cc3c(cc2nc1SCC(=O)N=C1C=CC(=S(=O)(O)NCc2ccccc2)C=C1)OCCO3 |
| InChI | InChI=1S/C27H25N3O5S2/c1-18-13-20-14-24-25(35-12-11-34-24)15-23(20)30-27(18)36-17-26(31)29-21-7-9-22(10-8-21)37(32,33)28-16-19-5-3-2-4-6-19/h2-10,13-15H,11-12,16-17H2,1H3,(H2,28,32,33) |
| InChIKey | PDQMEDXBKUOQGR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 110.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|