About 2-(difluoromethyl)-4H-pyrrolo[2,3-b]pyridine
2-(difluoromethyl)-4H-pyrrolo[2,3-b]pyridine (PubChem CID 126421781) has the molecular formula C8H6F2N2
and a molecular weight of 168.15 g/mol. Its IUPAC name is 2-(difluoromethyl)-4H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 2-(difluoromethyl)-4H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 126421781 |
| Molecular Formula | C8H6F2N2 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | 2-(difluoromethyl)-4H-pyrrolo[2,3-b]pyridine |
| SMILES | FC(F)C1=NC2=NC=CCC2=C1 |
| InChI | InChI=1S/C8H6F2N2/c9-7(10)6-4-5-2-1-3-11-8(5)12-6/h1,3-4,7H,2H2 |
| InChIKey | MYEZPLMLVXLSTA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(difluoromethyl)-4H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethyl)-4H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 2-(difluoromethyl)-4H-pyrrolo[2,3-b]pyridine (CID 126421781) is 2-(difluoromethyl)-4H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 2-(difluoromethyl)-4H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 2-(difluoromethyl)-4H-pyrrolo[2,3-b]pyridine is FC(F)C1=NC2=NC=CCC2=C1.
What is the InChIKey of 2-(difluoromethyl)-4H-pyrrolo[2,3-b]pyridine?
The InChIKey is MYEZPLMLVXLSTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F2N2/c9-7(10)6-4-5-2-1-3-11-8(5)12-6/h1,3-4,7H,2H2.
What are the key properties of 2-(difluoromethyl)-4H-pyrrolo[2,3-b]pyridine?
2-(difluoromethyl)-4H-pyrrolo[2,3-b]pyridine has a molecular weight of 168.15 g/mol, XLogP of 1.95, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethyl)-4H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 126421781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).