About ethyl 2-iminobutanoate
ethyl 2-iminobutanoate (PubChem CID 12642259) has the molecular formula C6H11NO2
and a molecular weight of 129.16 g/mol. Its IUPAC name is ethyl 2-iminobutanoate.
Molecular Properties
| Compound Name | ethyl 2-iminobutanoate |
| PubChem CID | 12642259 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | ethyl 2-iminobutanoate |
| SMILES | [H]/N=C(\CC)C(=O)OCC |
| InChI | InChI=1S/C6H11NO2/c1-3-5(7)6(8)9-4-2/h7H,3-4H2,1-2H3/b7-5+ |
| InChIKey | UIKOVWUYANJUPR-FNORWQNLSA-N |
| XLogP | 0.98 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-iminobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-iminobutanoate?
The IUPAC name of ethyl 2-iminobutanoate (CID 12642259) is ethyl 2-iminobutanoate.
What is the SMILES notation for ethyl 2-iminobutanoate?
The canonical SMILES for ethyl 2-iminobutanoate is [H]/N=C(\CC)C(=O)OCC.
What is the InChIKey of ethyl 2-iminobutanoate?
The InChIKey is UIKOVWUYANJUPR-FNORWQNLSA-N. The full InChI is InChI=1S/C6H11NO2/c1-3-5(7)6(8)9-4-2/h7H,3-4H2,1-2H3/b7-5+.
What are the key properties of ethyl 2-iminobutanoate?
ethyl 2-iminobutanoate has a molecular weight of 129.16 g/mol, XLogP of 0.98, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-iminobutanoate is sourced from PubChem (CID 12642259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).