C17H19N5O3S — CID 126423395
1-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-1-methyl-3-[(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)methyl]urea (PubChem CID 126423395) has the molecular formula C17H19N5O3S and a molecular weight of 373.44 g/mol. Its IUPAC name is 1-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-1-methyl-3-[(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)methyl]urea.
| Compound Name | 1-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-1-methyl-3-[(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)methyl]urea |
|---|---|
| PubChem CID | 126423395 |
| Molecular Formula | C17H19N5O3S |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 1-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-1-methyl-3-[(2-methylimidazo[2,1-b][1,3,4]thiadiazol-6-yl)methyl]urea |
| SMILES | Cc1nn2cc(CNC(=O)N(C)C[C@@H]3COc4ccccc4O3)nc2s1 |
| InChI | InChI=1S/C17H19N5O3S/c1-11-20-22-8-12(19-17(22)26-11)7-18-16(23)21(2)9-13-10-24-14-5-3-4-6-15(14)25-13/h3-6,8,13H,7,9-10H2,1-2H3,(H,18,23)/t13-/m1/s1 |
| InChIKey | RUWWBVLFTIJLSF-CYBMUJFWSA-N |
| XLogP | 2.08 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |