About 3-methylbutanoyl isocyanate
3-methylbutanoyl isocyanate (PubChem CID 12642343) has the molecular formula C6H9NO2
and a molecular weight of 127.14 g/mol. Its IUPAC name is 3-methylbutanoyl isocyanate.
Molecular Properties
| Compound Name | 3-methylbutanoyl isocyanate |
| PubChem CID | 12642343 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | 3-methylbutanoyl isocyanate |
| SMILES | CC(C)CC(=O)N=C=O |
| InChI | InChI=1S/C6H9NO2/c1-5(2)3-6(9)7-4-8/h5H,3H2,1-2H3 |
| InChIKey | XQSJJVGHAOBRFS-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbutanoyl isocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutanoyl isocyanate?
The IUPAC name of 3-methylbutanoyl isocyanate (CID 12642343) is 3-methylbutanoyl isocyanate.
What is the SMILES notation for 3-methylbutanoyl isocyanate?
The canonical SMILES for 3-methylbutanoyl isocyanate is CC(C)CC(=O)N=C=O.
What is the InChIKey of 3-methylbutanoyl isocyanate?
The InChIKey is XQSJJVGHAOBRFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2/c1-5(2)3-6(9)7-4-8/h5H,3H2,1-2H3.
What are the key properties of 3-methylbutanoyl isocyanate?
3-methylbutanoyl isocyanate has a molecular weight of 127.14 g/mol, XLogP of 0.89, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutanoyl isocyanate is sourced from PubChem (CID 12642343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).