C16H28N4O2 — CID 126423565
(2S)-2-(3-methoxypropyl)-N-(1-propan-2-ylpyrazol-4-yl)piperidine-1-carboxamide (PubChem CID 126423565) has the molecular formula C16H28N4O2 and a molecular weight of 308.43 g/mol. Its IUPAC name is (2S)-2-(3-methoxypropyl)-N-(1-propan-2-ylpyrazol-4-yl)piperidine-1-carboxamide.
| Compound Name | (2S)-2-(3-methoxypropyl)-N-(1-propan-2-ylpyrazol-4-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 126423565 |
| Molecular Formula | C16H28N4O2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | (2S)-2-(3-methoxypropyl)-N-(1-propan-2-ylpyrazol-4-yl)piperidine-1-carboxamide |
| SMILES | COCCC[C@@H]1CCCCN1C(=O)Nc1cnn(C(C)C)c1 |
| InChI | InChI=1S/C16H28N4O2/c1-13(2)20-12-14(11-17-20)18-16(21)19-9-5-4-7-15(19)8-6-10-22-3/h11-13,15H,4-10H2,1-3H3,(H,18,21)/t15-/m0/s1 |
| InChIKey | BNDYFWXLHKJUFF-HNNXBMFYSA-N |
| XLogP | 3.28 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|