C11H17N3O3 — CID 126423651
(1S)-2,2-dimethyl-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]cyclopropane-1-carboxamide (PubChem CID 126423651) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is (1S)-2,2-dimethyl-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]cyclopropane-1-carboxamide.
| Compound Name | (1S)-2,2-dimethyl-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 126423651 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | (1S)-2,2-dimethyl-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]cyclopropane-1-carboxamide |
| SMILES | Cc1nonc1OCCNC(=O)[C@H]1CC1(C)C |
| InChI | InChI=1S/C11H17N3O3/c1-7-10(14-17-13-7)16-5-4-12-9(15)8-6-11(8,2)3/h8H,4-6H2,1-3H3,(H,12,15)/t8-/m1/s1 |
| InChIKey | FHKRKECZZPQJLZ-MRVPVSSYSA-N |
| XLogP | 0.92 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|