C17H22N6OS — CID 126423797
(2R)-2-(2-propylbenzimidazol-1-yl)-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]propanamide (PubChem CID 126423797) has the molecular formula C17H22N6OS and a molecular weight of 358.47 g/mol. Its IUPAC name is (2R)-2-(2-propylbenzimidazol-1-yl)-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]propanamide.
| Compound Name | (2R)-2-(2-propylbenzimidazol-1-yl)-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]propanamide |
|---|---|
| PubChem CID | 126423797 |
| Molecular Formula | C17H22N6OS |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | (2R)-2-(2-propylbenzimidazol-1-yl)-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]propanamide |
| SMILES | CCCc1nc2ccccc2n1[C@H](C)C(=O)NCCSc1cn[nH]n1 |
| InChI | InChI=1S/C17H22N6OS/c1-3-6-15-20-13-7-4-5-8-14(13)23(15)12(2)17(24)18-9-10-25-16-11-19-22-21-16/h4-5,7-8,11-12H,3,6,9-10H2,1-2H3,(H,18,24)(H,19,21,22)/t12-/m1/s1 |
| InChIKey | GZNLGYVBDPCBMK-GFCCVEGCSA-N |
| XLogP | 2.58 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|