C16H26N4O2 — CID 126423883
1-[(2R)-3-(azepan-1-yl)-2-hydroxypropyl]-3-(pyridin-2-ylmethyl)urea (PubChem CID 126423883) has the molecular formula C16H26N4O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-[(2R)-3-(azepan-1-yl)-2-hydroxypropyl]-3-(pyridin-2-ylmethyl)urea.
| Compound Name | 1-[(2R)-3-(azepan-1-yl)-2-hydroxypropyl]-3-(pyridin-2-ylmethyl)urea |
|---|---|
| PubChem CID | 126423883 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 1-[(2R)-3-(azepan-1-yl)-2-hydroxypropyl]-3-(pyridin-2-ylmethyl)urea |
| SMILES | O=C(NCc1ccccn1)NC[C@@H](O)CN1CCCCCC1 |
| InChI | InChI=1S/C16H26N4O2/c21-15(13-20-9-5-1-2-6-10-20)12-19-16(22)18-11-14-7-3-4-8-17-14/h3-4,7-8,15,21H,1-2,5-6,9-13H2,(H2,18,19,22)/t15-/m1/s1 |
| InChIKey | ATZNAVDCDKXCBX-OAHLLOKOSA-N |
| XLogP | 1.12 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |