About benzene;dichlorotitanium
benzene;dichlorotitanium (PubChem CID 12642478) has the molecular formula C12H10Cl2Ti-2
and a molecular weight of 272.99 g/mol. Its IUPAC name is benzene;dichlorotitanium.
Molecular Properties
| Compound Name | benzene;dichlorotitanium |
| PubChem CID | 12642478 |
| Molecular Formula | C12H10Cl2Ti-2 |
| Molecular Weight | 272.99 g/mol |
| Exact Mass | 271.96 |
| IUPAC Name | benzene;dichlorotitanium |
| SMILES | Cl[Ti]Cl.[c-]1ccccc1.[c-]1ccccc1 |
| InChI | InChI=1S/2C6H5.2ClH.Ti/c2*1-2-4-6-5-3-1;;;/h2*1-5H;2*1H;/q2*-1;;;+2/p-2 |
| InChIKey | MHHUSBZJPQTUKS-UHFFFAOYSA-L |
| XLogP | 4.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.99 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze benzene;dichlorotitanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;dichlorotitanium?
The IUPAC name of benzene;dichlorotitanium (CID 12642478) is benzene;dichlorotitanium.
What is the SMILES notation for benzene;dichlorotitanium?
The canonical SMILES for benzene;dichlorotitanium is Cl[Ti]Cl.[c-]1ccccc1.[c-]1ccccc1.
What is the InChIKey of benzene;dichlorotitanium?
The InChIKey is MHHUSBZJPQTUKS-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H5.2ClH.Ti/c2*1-2-4-6-5-3-1;;;/h2*1-5H;2*1H;/q2*-1;;;+2/p-2.
What are the key properties of benzene;dichlorotitanium?
benzene;dichlorotitanium has a molecular weight of 272.99 g/mol, XLogP of 4.35, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;dichlorotitanium is sourced from PubChem (CID 12642478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).