C21H30N4O2 — CID 126424800
N-[(1-ethylpyrazol-4-yl)methyl]-4-[(1S)-1-hydroxy-3-phenylpropyl]piperidine-1-carboxamide (PubChem CID 126424800) has the molecular formula C21H30N4O2 and a molecular weight of 370.50 g/mol. Its IUPAC name is N-[(1-ethylpyrazol-4-yl)methyl]-4-[(1S)-1-hydroxy-3-phenylpropyl]piperidine-1-carboxamide.
| Compound Name | N-[(1-ethylpyrazol-4-yl)methyl]-4-[(1S)-1-hydroxy-3-phenylpropyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 126424800 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | N-[(1-ethylpyrazol-4-yl)methyl]-4-[(1S)-1-hydroxy-3-phenylpropyl]piperidine-1-carboxamide |
| SMILES | CCn1cc(CNC(=O)N2CCC([C@@H](O)CCc3ccccc3)CC2)cn1 |
| InChI | InChI=1S/C21H30N4O2/c1-2-25-16-18(15-23-25)14-22-21(27)24-12-10-19(11-13-24)20(26)9-8-17-6-4-3-5-7-17/h3-7,15-16,19-20,26H,2,8-14H2,1H3,(H,22,27)/t20-/m0/s1 |
| InChIKey | FXSXQEFDRCDGKE-FQEVSTJZSA-N |
| XLogP | 2.82 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |