About (2S)-N-(imidazo[1,2-a]pyrazin-3-ylmethyl)spiro[2.5]octane-2-carboxamide
(2S)-N-(imidazo[1,2-a]pyrazin-3-ylmethyl)spiro[2.5]octane-2-carboxamide (PubChem CID 126424942) has the molecular formula C16H20N4O
and a molecular weight of 284.36 g/mol. Its IUPAC name is (2S)-N-(imidazo[1,2-a]pyrazin-3-ylmethyl)spiro[2.5]octane-2-carboxamide.
Molecular Properties
| Compound Name | (2S)-N-(imidazo[1,2-a]pyrazin-3-ylmethyl)spiro[2.5]octane-2-carboxamide |
| PubChem CID | 126424942 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (2S)-N-(imidazo[1,2-a]pyrazin-3-ylmethyl)spiro[2.5]octane-2-carboxamide |
| SMILES | O=C(NCc1cnc2cnccn12)[C@H]1CC12CCCCC2 |
| InChI | InChI=1S/C16H20N4O/c21-15(13-8-16(13)4-2-1-3-5-16)19-10-12-9-18-14-11-17-6-7-20(12)14/h6-7,9,11,13H,1-5,8,10H2,(H,19,21)/t13-/m1/s1 |
| InChIKey | UCUIBTPQDGUURT-CYBMUJFWSA-N |
| XLogP | 2.32 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-N-(imidazo[1,2-a]pyrazin-3-ylmethyl)spiro[2.5]octane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-(imidazo[1,2-a]pyrazin-3-ylmethyl)spiro[2.5]octane-2-carboxamide?
The IUPAC name of (2S)-N-(imidazo[1,2-a]pyrazin-3-ylmethyl)spiro[2.5]octane-2-carboxamide (CID 126424942) is (2S)-N-(imidazo[1,2-a]pyrazin-3-ylmethyl)spiro[2.5]octane-2-carboxamide.
What is the SMILES notation for (2S)-N-(imidazo[1,2-a]pyrazin-3-ylmethyl)spiro[2.5]octane-2-carboxamide?
The canonical SMILES for (2S)-N-(imidazo[1,2-a]pyrazin-3-ylmethyl)spiro[2.5]octane-2-carboxamide is O=C(NCc1cnc2cnccn12)[C@H]1CC12CCCCC2.
What is the InChIKey of (2S)-N-(imidazo[1,2-a]pyrazin-3-ylmethyl)spiro[2.5]octane-2-carboxamide?
The InChIKey is UCUIBTPQDGUURT-CYBMUJFWSA-N. The full InChI is InChI=1S/C16H20N4O/c21-15(13-8-16(13)4-2-1-3-5-16)19-10-12-9-18-14-11-17-6-7-20(12)14/h6-7,9,11,13H,1-5,8,10H2,(H,19,21)/t13-/m1/s1.
What are the key properties of (2S)-N-(imidazo[1,2-a]pyrazin-3-ylmethyl)spiro[2.5]octane-2-carboxamide?
(2S)-N-(imidazo[1,2-a]pyrazin-3-ylmethyl)spiro[2.5]octane-2-carboxamide has a molecular weight of 284.36 g/mol, XLogP of 2.32, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-(imidazo[1,2-a]pyrazin-3-ylmethyl)spiro[2.5]octane-2-carboxamide is sourced from PubChem (CID 126424942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).