About methyl 4-[4-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamoyl]phenyl]-1H-pyrrole-2-carboxylate
methyl 4-[4-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamoyl]phenyl]-1H-pyrrole-2-carboxylate (PubChem CID 126425416) has the molecular formula C18H20N2O5S
and a molecular weight of 376.43 g/mol. Its IUPAC name is methyl 4-[4-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamoyl]phenyl]-1H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | methyl 4-[4-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamoyl]phenyl]-1H-pyrrole-2-carboxylate |
| PubChem CID | 126425416 |
| Molecular Formula | C18H20N2O5S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | methyl 4-[4-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamoyl]phenyl]-1H-pyrrole-2-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccc(C(=O)N[C@@]3(C)CCS(=O)(=O)C3)cc2)c[nH]1 |
| InChI | InChI=1S/C18H20N2O5S/c1-18(7-8-26(23,24)11-18)20-16(21)13-5-3-12(4-6-13)14-9-15(19-10-14)17(22)25-2/h3-6,9-10,19H,7-8,11H2,1-2H3,(H,20,21)/t18-/m0/s1 |
| InChIKey | VLDAXVMBKRRVAB-SFHVURJKSA-N |
| XLogP | 1.78 |
| TPSA | 105.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-[4-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamoyl]phenyl]-1H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[4-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamoyl]phenyl]-1H-pyrrole-2-carboxylate?
The IUPAC name of methyl 4-[4-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamoyl]phenyl]-1H-pyrrole-2-carboxylate (CID 126425416) is methyl 4-[4-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamoyl]phenyl]-1H-pyrrole-2-carboxylate.
What is the SMILES notation for methyl 4-[4-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamoyl]phenyl]-1H-pyrrole-2-carboxylate?
The canonical SMILES for methyl 4-[4-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamoyl]phenyl]-1H-pyrrole-2-carboxylate is COC(=O)c1cc(-c2ccc(C(=O)N[C@@]3(C)CCS(=O)(=O)C3)cc2)c[nH]1.
What is the InChIKey of methyl 4-[4-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamoyl]phenyl]-1H-pyrrole-2-carboxylate?
The InChIKey is VLDAXVMBKRRVAB-SFHVURJKSA-N. The full InChI is InChI=1S/C18H20N2O5S/c1-18(7-8-26(23,24)11-18)20-16(21)13-5-3-12(4-6-13)14-9-15(19-10-14)17(22)25-2/h3-6,9-10,19H,7-8,11H2,1-2H3,(H,20,21)/t18-/m0/s1.
What are the key properties of methyl 4-[4-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamoyl]phenyl]-1H-pyrrole-2-carboxylate?
methyl 4-[4-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamoyl]phenyl]-1H-pyrrole-2-carboxylate has a molecular weight of 376.43 g/mol, XLogP of 1.78, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[4-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]carbamoyl]phenyl]-1H-pyrrole-2-carboxylate is sourced from PubChem (CID 126425416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).