C16H28N2O3S — CID 126426793
(2R)-4-methylsulfanyl-2-[(1-pyrrolidin-1-ylcyclohexanecarbonyl)amino]butanoic acid (PubChem CID 126426793) has the molecular formula C16H28N2O3S and a molecular weight of 328.48 g/mol. Its IUPAC name is (2R)-4-methylsulfanyl-2-[(1-pyrrolidin-1-ylcyclohexanecarbonyl)amino]butanoic acid.
| Compound Name | (2R)-4-methylsulfanyl-2-[(1-pyrrolidin-1-ylcyclohexanecarbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 126426793 |
| Molecular Formula | C16H28N2O3S |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | (2R)-4-methylsulfanyl-2-[(1-pyrrolidin-1-ylcyclohexanecarbonyl)amino]butanoic acid |
| SMILES | CSCC[C@@H](NC(=O)C1(N2CCCC2)CCCCC1)C(=O)O |
| InChI | InChI=1S/C16H28N2O3S/c1-22-12-7-13(14(19)20)17-15(21)16(8-3-2-4-9-16)18-10-5-6-11-18/h13H,2-12H2,1H3,(H,17,21)(H,19,20)/t13-/m1/s1 |
| InChIKey | IEULOJNIYVXFLZ-CYBMUJFWSA-N |
| XLogP | 2.11 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |