About (2S)-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]spiro[2.5]octane-2-carboxamide
(2S)-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]spiro[2.5]octane-2-carboxamide (PubChem CID 126428326) has the molecular formula C14H21N3O3
and a molecular weight of 279.34 g/mol. Its IUPAC name is (2S)-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]spiro[2.5]octane-2-carboxamide.
Molecular Properties
| Compound Name | (2S)-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]spiro[2.5]octane-2-carboxamide |
| PubChem CID | 126428326 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | (2S)-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]spiro[2.5]octane-2-carboxamide |
| SMILES | Cc1nonc1OCCNC(=O)[C@H]1CC12CCCCC2 |
| InChI | InChI=1S/C14H21N3O3/c1-10-13(17-20-16-10)19-8-7-15-12(18)11-9-14(11)5-3-2-4-6-14/h11H,2-9H2,1H3,(H,15,18)/t11-/m1/s1 |
| InChIKey | LSUWQNBUYRXNLE-LLVKDONJSA-N |
| XLogP | 1.84 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]spiro[2.5]octane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]spiro[2.5]octane-2-carboxamide?
The IUPAC name of (2S)-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]spiro[2.5]octane-2-carboxamide (CID 126428326) is (2S)-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]spiro[2.5]octane-2-carboxamide.
What is the SMILES notation for (2S)-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]spiro[2.5]octane-2-carboxamide?
The canonical SMILES for (2S)-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]spiro[2.5]octane-2-carboxamide is Cc1nonc1OCCNC(=O)[C@H]1CC12CCCCC2.
What is the InChIKey of (2S)-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]spiro[2.5]octane-2-carboxamide?
The InChIKey is LSUWQNBUYRXNLE-LLVKDONJSA-N. The full InChI is InChI=1S/C14H21N3O3/c1-10-13(17-20-16-10)19-8-7-15-12(18)11-9-14(11)5-3-2-4-6-14/h11H,2-9H2,1H3,(H,15,18)/t11-/m1/s1.
What are the key properties of (2S)-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]spiro[2.5]octane-2-carboxamide?
(2S)-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]spiro[2.5]octane-2-carboxamide has a molecular weight of 279.34 g/mol, XLogP of 1.84, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]spiro[2.5]octane-2-carboxamide is sourced from PubChem (CID 126428326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).