About but-1-ene-1,3-dione
but-1-ene-1,3-dione (PubChem CID 12642904) has the molecular formula C4H4O2
and a molecular weight of 84.07 g/mol. Its IUPAC name is but-1-ene-1,3-dione.
Molecular Properties
| Compound Name | but-1-ene-1,3-dione |
| PubChem CID | 12642904 |
| Molecular Formula | C4H4O2 |
| Molecular Weight | 84.07 g/mol |
| Exact Mass | 84.02 |
| IUPAC Name | but-1-ene-1,3-dione |
| SMILES | CC(=O)C=C=O |
| InChI | InChI=1S/C4H4O2/c1-4(6)2-3-5/h2H,1H3 |
| InChIKey | BWRFQFVRMJWEQW-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 84.07 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze but-1-ene-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-ene-1,3-dione?
The IUPAC name of but-1-ene-1,3-dione (CID 12642904) is but-1-ene-1,3-dione.
What is the SMILES notation for but-1-ene-1,3-dione?
The canonical SMILES for but-1-ene-1,3-dione is CC(=O)C=C=O.
What is the InChIKey of but-1-ene-1,3-dione?
The InChIKey is BWRFQFVRMJWEQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4O2/c1-4(6)2-3-5/h2H,1H3.
What are the key properties of but-1-ene-1,3-dione?
but-1-ene-1,3-dione has a molecular weight of 84.07 g/mol, XLogP of -0.04, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-ene-1,3-dione is sourced from PubChem (CID 12642904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).