C19H19F2NO3 — CID 126429664
4-(3,4-difluoro-5-hydroxyphenyl)-N-[[(3S)-oxan-3-yl]methyl]benzamide (PubChem CID 126429664) has the molecular formula C19H19F2NO3 and a molecular weight of 347.36 g/mol. Its IUPAC name is 4-(3,4-difluoro-5-hydroxyphenyl)-N-[[(3S)-oxan-3-yl]methyl]benzamide.
| Compound Name | 4-(3,4-difluoro-5-hydroxyphenyl)-N-[[(3S)-oxan-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 126429664 |
| Molecular Formula | C19H19F2NO3 |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 4-(3,4-difluoro-5-hydroxyphenyl)-N-[[(3S)-oxan-3-yl]methyl]benzamide |
| SMILES | O=C(NC[C@@H]1CCCOC1)c1ccc(-c2cc(O)c(F)c(F)c2)cc1 |
| InChI | InChI=1S/C19H19F2NO3/c20-16-8-15(9-17(23)18(16)21)13-3-5-14(6-4-13)19(24)22-10-12-2-1-7-25-11-12/h3-6,8-9,12,23H,1-2,7,10-11H2,(H,22,24)/t12-/m0/s1 |
| InChIKey | SRHJETOJGAYGLK-LBPRGKRZSA-N |
| XLogP | 3.49 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |