About 5-propan-2-yl-1,3-oxazolidine-2-thione
5-propan-2-yl-1,3-oxazolidine-2-thione (PubChem CID 12642977) has the molecular formula C6H11NOS
and a molecular weight of 145.23 g/mol. Its IUPAC name is 5-propan-2-yl-1,3-oxazolidine-2-thione.
Molecular Properties
| Compound Name | 5-propan-2-yl-1,3-oxazolidine-2-thione |
| PubChem CID | 12642977 |
| Molecular Formula | C6H11NOS |
| Molecular Weight | 145.23 g/mol |
| Exact Mass | 145.06 |
| IUPAC Name | 5-propan-2-yl-1,3-oxazolidine-2-thione |
| SMILES | CC(C)C1CNC(=S)O1 |
| InChI | InChI=1S/C6H11NOS/c1-4(2)5-3-7-6(9)8-5/h4-5H,3H2,1-2H3,(H,7,9) |
| InChIKey | QMUVSKZDLNAFSG-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.23 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-propan-2-yl-1,3-oxazolidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propan-2-yl-1,3-oxazolidine-2-thione?
The IUPAC name of 5-propan-2-yl-1,3-oxazolidine-2-thione (CID 12642977) is 5-propan-2-yl-1,3-oxazolidine-2-thione.
What is the SMILES notation for 5-propan-2-yl-1,3-oxazolidine-2-thione?
The canonical SMILES for 5-propan-2-yl-1,3-oxazolidine-2-thione is CC(C)C1CNC(=S)O1.
What is the InChIKey of 5-propan-2-yl-1,3-oxazolidine-2-thione?
The InChIKey is QMUVSKZDLNAFSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NOS/c1-4(2)5-3-7-6(9)8-5/h4-5H,3H2,1-2H3,(H,7,9).
What are the key properties of 5-propan-2-yl-1,3-oxazolidine-2-thione?
5-propan-2-yl-1,3-oxazolidine-2-thione has a molecular weight of 145.23 g/mol, XLogP of 0.92, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propan-2-yl-1,3-oxazolidine-2-thione is sourced from PubChem (CID 12642977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).