About (3-pentan-3-ylphenyl) N-methylcarbamate
(3-pentan-3-ylphenyl) N-methylcarbamate (PubChem CID 12643) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is (3-pentan-3-ylphenyl) N-methylcarbamate.
Molecular Properties
| Compound Name | (3-pentan-3-ylphenyl) N-methylcarbamate |
| PubChem CID | 12643 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (3-pentan-3-ylphenyl) N-methylcarbamate |
| SMILES | CCC(CC)c1cccc(OC(=O)NC)c1 |
| InChI | InChI=1S/C13H19NO2/c1-4-10(5-2)11-7-6-8-12(9-11)16-13(15)14-3/h6-10H,4-5H2,1-3H3,(H,14,15) |
| InChIKey | SMSFWBAOKCZZBF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-pentan-3-ylphenyl) N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-pentan-3-ylphenyl) N-methylcarbamate?
The IUPAC name of (3-pentan-3-ylphenyl) N-methylcarbamate (CID 12643) is (3-pentan-3-ylphenyl) N-methylcarbamate.
What is the SMILES notation for (3-pentan-3-ylphenyl) N-methylcarbamate?
The canonical SMILES for (3-pentan-3-ylphenyl) N-methylcarbamate is CCC(CC)c1cccc(OC(=O)NC)c1.
What is the InChIKey of (3-pentan-3-ylphenyl) N-methylcarbamate?
The InChIKey is SMSFWBAOKCZZBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2/c1-4-10(5-2)11-7-6-8-12(9-11)16-13(15)14-3/h6-10H,4-5H2,1-3H3,(H,14,15).
What are the key properties of (3-pentan-3-ylphenyl) N-methylcarbamate?
(3-pentan-3-ylphenyl) N-methylcarbamate has a molecular weight of 221.30 g/mol, XLogP of 3.31, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-pentan-3-ylphenyl) N-methylcarbamate is sourced from PubChem (CID 12643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).