C22H29N3O — CID 126431492
(2R)-N-[3-(2-ethylimidazol-1-yl)propyl]-2-phenylspiro[2.4]heptane-2-carboxamide (PubChem CID 126431492) has the molecular formula C22H29N3O and a molecular weight of 351.49 g/mol. Its IUPAC name is (2R)-N-[3-(2-ethylimidazol-1-yl)propyl]-2-phenylspiro[2.4]heptane-2-carboxamide.
| Compound Name | (2R)-N-[3-(2-ethylimidazol-1-yl)propyl]-2-phenylspiro[2.4]heptane-2-carboxamide |
|---|---|
| PubChem CID | 126431492 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | (2R)-N-[3-(2-ethylimidazol-1-yl)propyl]-2-phenylspiro[2.4]heptane-2-carboxamide |
| SMILES | CCc1nccn1CCCNC(=O)[C@]1(c2ccccc2)CC12CCCC2 |
| InChI | InChI=1S/C22H29N3O/c1-2-19-23-14-16-25(19)15-8-13-24-20(26)22(18-9-4-3-5-10-18)17-21(22)11-6-7-12-21/h3-5,9-10,14,16H,2,6-8,11-13,15,17H2,1H3,(H,24,26)/t22-/m1/s1 |
| InChIKey | MGJOODZAICCVAI-JOCHJYFZSA-N |
| XLogP | 3.85 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|