About dichloromethoxyethane
dichloromethoxyethane (PubChem CID 12643245) has the molecular formula C3H6Cl2O
and a molecular weight of 128.99 g/mol. Its IUPAC name is dichloromethoxyethane.
Molecular Properties
| Compound Name | dichloromethoxyethane |
| PubChem CID | 12643245 |
| Molecular Formula | C3H6Cl2O |
| Molecular Weight | 128.99 g/mol |
| Exact Mass | 127.98 |
| IUPAC Name | dichloromethoxyethane |
| SMILES | CCOC(Cl)Cl |
| InChI | InChI=1S/C3H6Cl2O/c1-2-6-3(4)5/h3H,2H2,1H3 |
| InChIKey | MJNJTZVLAVUIDU-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.99 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze dichloromethoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromethoxyethane?
The IUPAC name of dichloromethoxyethane (CID 12643245) is dichloromethoxyethane.
What is the SMILES notation for dichloromethoxyethane?
The canonical SMILES for dichloromethoxyethane is CCOC(Cl)Cl.
What is the InChIKey of dichloromethoxyethane?
The InChIKey is MJNJTZVLAVUIDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6Cl2O/c1-2-6-3(4)5/h3H,2H2,1H3.
What are the key properties of dichloromethoxyethane?
dichloromethoxyethane has a molecular weight of 128.99 g/mol, XLogP of 1.78, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethoxyethane is sourced from PubChem (CID 12643245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).