C18H25N3O — CID 126432648
2-[4-[4-[(1S)-1-piperidin-1-ylethyl]phenyl]pyrazol-1-yl]ethanol (PubChem CID 126432648) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is 2-[4-[4-[(1S)-1-piperidin-1-ylethyl]phenyl]pyrazol-1-yl]ethanol.
| Compound Name | 2-[4-[4-[(1S)-1-piperidin-1-ylethyl]phenyl]pyrazol-1-yl]ethanol |
|---|---|
| PubChem CID | 126432648 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 2-[4-[4-[(1S)-1-piperidin-1-ylethyl]phenyl]pyrazol-1-yl]ethanol |
| SMILES | C[C@@H](c1ccc(-c2cnn(CCO)c2)cc1)N1CCCCC1 |
| InChI | InChI=1S/C18H25N3O/c1-15(20-9-3-2-4-10-20)16-5-7-17(8-6-16)18-13-19-21(14-18)11-12-22/h5-8,13-15,22H,2-4,9-12H2,1H3/t15-/m0/s1 |
| InChIKey | AQYCKNOSFVTSAE-HNNXBMFYSA-N |
| XLogP | 3.09 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |