About 5,5-dimethyl-[1]benzosilino[3,2-c]pyridin-10-one
5,5-dimethyl-[1]benzosilino[3,2-c]pyridin-10-one (PubChem CID 12643272) has the molecular formula C14H13NOSi
and a molecular weight of 239.35 g/mol. Its IUPAC name is 5,5-dimethyl-[1]benzosilino[3,2-c]pyridin-10-one.
Molecular Properties
| Compound Name | 5,5-dimethyl-[1]benzosilino[3,2-c]pyridin-10-one |
| PubChem CID | 12643272 |
| Molecular Formula | C14H13NOSi |
| Molecular Weight | 239.35 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 5,5-dimethyl-[1]benzosilino[3,2-c]pyridin-10-one |
| SMILES | C[Si]1(C)c2ccccc2C(=O)c2cnccc21 |
| InChI | InChI=1S/C14H13NOSi/c1-17(2)12-6-4-3-5-10(12)14(16)11-9-15-8-7-13(11)17/h3-9H,1-2H3 |
| InChIKey | PJHCFMLFLIVLQY-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dimethyl-[1]benzosilino[3,2-c]pyridin-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-[1]benzosilino[3,2-c]pyridin-10-one?
The IUPAC name of 5,5-dimethyl-[1]benzosilino[3,2-c]pyridin-10-one (CID 12643272) is 5,5-dimethyl-[1]benzosilino[3,2-c]pyridin-10-one.
What is the SMILES notation for 5,5-dimethyl-[1]benzosilino[3,2-c]pyridin-10-one?
The canonical SMILES for 5,5-dimethyl-[1]benzosilino[3,2-c]pyridin-10-one is C[Si]1(C)c2ccccc2C(=O)c2cnccc21.
What is the InChIKey of 5,5-dimethyl-[1]benzosilino[3,2-c]pyridin-10-one?
The InChIKey is PJHCFMLFLIVLQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NOSi/c1-17(2)12-6-4-3-5-10(12)14(16)11-9-15-8-7-13(11)17/h3-9H,1-2H3.
What are the key properties of 5,5-dimethyl-[1]benzosilino[3,2-c]pyridin-10-one?
5,5-dimethyl-[1]benzosilino[3,2-c]pyridin-10-one has a molecular weight of 239.35 g/mol, XLogP of 1.45, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-[1]benzosilino[3,2-c]pyridin-10-one is sourced from PubChem (CID 12643272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).