C19H29N3 — CID 126432847
2-[(3S)-1-phenylpyrrolidin-3-yl]-2,9-diazaspiro[5.5]undecane (PubChem CID 126432847) has the molecular formula C19H29N3 and a molecular weight of 299.46 g/mol. Its IUPAC name is 2-[(3S)-1-phenylpyrrolidin-3-yl]-2,9-diazaspiro[5.5]undecane.
| Compound Name | 2-[(3S)-1-phenylpyrrolidin-3-yl]-2,9-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 126432847 |
| Molecular Formula | C19H29N3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | 2-[(3S)-1-phenylpyrrolidin-3-yl]-2,9-diazaspiro[5.5]undecane |
| SMILES | c1ccc(N2CC[C@H](N3CCCC4(CCNCC4)C3)C2)cc1 |
| InChI | InChI=1S/C19H29N3/c1-2-5-17(6-3-1)21-14-7-18(15-21)22-13-4-8-19(16-22)9-11-20-12-10-19/h1-3,5-6,18,20H,4,7-16H2/t18-/m0/s1 |
| InChIKey | DMNMQCLATUTFSL-SFHVURJKSA-N |
| XLogP | 2.73 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |