C8H12F6O2 — CID 12643288
2-methyl-1,1-bis(2,2,2-trifluoroethoxy)propane (PubChem CID 12643288) has the molecular formula C8H12F6O2 and a molecular weight of 254.17 g/mol. Its IUPAC name is 2-methyl-1,1-bis(2,2,2-trifluoroethoxy)propane.
| Compound Name | 2-methyl-1,1-bis(2,2,2-trifluoroethoxy)propane |
|---|---|
| PubChem CID | 12643288 |
| Molecular Formula | C8H12F6O2 |
| Molecular Weight | 254.17 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 2-methyl-1,1-bis(2,2,2-trifluoroethoxy)propane |
| SMILES | CC(C)C(OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C8H12F6O2/c1-5(2)6(15-3-7(9,10)11)16-4-8(12,13)14/h5-6H,3-4H2,1-2H3 |
| InChIKey | IJZYHFMZWWIULW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.17 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|