About 4-(1,3-benzodioxol-5-ylmethyl)-N-benzylpiperazine-1-carbothioamide
4-(1,3-benzodioxol-5-ylmethyl)-N-benzylpiperazine-1-carbothioamide (PubChem CID 1264336) has the molecular formula C20H23N3O2S
and a molecular weight of 369.49 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethyl)-N-benzylpiperazine-1-carbothioamide.
Molecular Properties
| Compound Name | 4-(1,3-benzodioxol-5-ylmethyl)-N-benzylpiperazine-1-carbothioamide |
| PubChem CID | 1264336 |
| Molecular Formula | C20H23N3O2S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethyl)-N-benzylpiperazine-1-carbothioamide |
| SMILES | S=C(NCc1ccccc1)N1CCN(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C20H23N3O2S/c26-20(21-13-16-4-2-1-3-5-16)23-10-8-22(9-11-23)14-17-6-7-18-19(12-17)25-15-24-18/h1-7,12H,8-11,13-15H2,(H,21,26) |
| InChIKey | DFDKXZVXHHTGSJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,3-benzodioxol-5-ylmethyl)-N-benzylpiperazine-1-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-benzodioxol-5-ylmethyl)-N-benzylpiperazine-1-carbothioamide?
The IUPAC name of 4-(1,3-benzodioxol-5-ylmethyl)-N-benzylpiperazine-1-carbothioamide (CID 1264336) is 4-(1,3-benzodioxol-5-ylmethyl)-N-benzylpiperazine-1-carbothioamide.
What is the SMILES notation for 4-(1,3-benzodioxol-5-ylmethyl)-N-benzylpiperazine-1-carbothioamide?
The canonical SMILES for 4-(1,3-benzodioxol-5-ylmethyl)-N-benzylpiperazine-1-carbothioamide is S=C(NCc1ccccc1)N1CCN(Cc2ccc3c(c2)OCO3)CC1.
What is the InChIKey of 4-(1,3-benzodioxol-5-ylmethyl)-N-benzylpiperazine-1-carbothioamide?
The InChIKey is DFDKXZVXHHTGSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N3O2S/c26-20(21-13-16-4-2-1-3-5-16)23-10-8-22(9-11-23)14-17-6-7-18-19(12-17)25-15-24-18/h1-7,12H,8-11,13-15H2,(H,21,26).
What are the key properties of 4-(1,3-benzodioxol-5-ylmethyl)-N-benzylpiperazine-1-carbothioamide?
4-(1,3-benzodioxol-5-ylmethyl)-N-benzylpiperazine-1-carbothioamide has a molecular weight of 369.49 g/mol, XLogP of 2.61, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzodioxol-5-ylmethyl)-N-benzylpiperazine-1-carbothioamide is sourced from PubChem (CID 1264336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).