C20H25N3O2 — CID 126434205
1-benzhydryl-3-[[(3S)-3-hydroxypiperidin-3-yl]methyl]urea (PubChem CID 126434205) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 1-benzhydryl-3-[[(3S)-3-hydroxypiperidin-3-yl]methyl]urea.
| Compound Name | 1-benzhydryl-3-[[(3S)-3-hydroxypiperidin-3-yl]methyl]urea |
|---|---|
| PubChem CID | 126434205 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 1-benzhydryl-3-[[(3S)-3-hydroxypiperidin-3-yl]methyl]urea |
| SMILES | O=C(NC[C@]1(O)CCCNC1)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H25N3O2/c24-19(22-15-20(25)12-7-13-21-14-20)23-18(16-8-3-1-4-9-16)17-10-5-2-6-11-17/h1-6,8-11,18,21,25H,7,12-15H2,(H2,22,23,24)/t20-/m0/s1 |
| InChIKey | PSZTVWBPWXEQHG-FQEVSTJZSA-N |
| XLogP | 2.19 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |