About methyl 6-[(3R)-2-oxo-3-phenyl-1,8-diazaspiro[4.5]decan-8-yl]pyridine-3-carboxylate
methyl 6-[(3R)-2-oxo-3-phenyl-1,8-diazaspiro[4.5]decan-8-yl]pyridine-3-carboxylate (PubChem CID 126434233) has the molecular formula C21H23N3O3
and a molecular weight of 365.43 g/mol. Its IUPAC name is methyl 6-[(3R)-2-oxo-3-phenyl-1,8-diazaspiro[4.5]decan-8-yl]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 6-[(3R)-2-oxo-3-phenyl-1,8-diazaspiro[4.5]decan-8-yl]pyridine-3-carboxylate |
| PubChem CID | 126434233 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | methyl 6-[(3R)-2-oxo-3-phenyl-1,8-diazaspiro[4.5]decan-8-yl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(N2CCC3(CC2)C[C@H](c2ccccc2)C(=O)N3)nc1 |
| InChI | InChI=1S/C21H23N3O3/c1-27-20(26)16-7-8-18(22-14-16)24-11-9-21(10-12-24)13-17(19(25)23-21)15-5-3-2-4-6-15/h2-8,14,17H,9-13H2,1H3,(H,23,25)/t17-/m1/s1 |
| InChIKey | HMRHPRNZNYCKNI-QGZVFWFLSA-N |
| XLogP | 2.51 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 6-[(3R)-2-oxo-3-phenyl-1,8-diazaspiro[4.5]decan-8-yl]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[(3R)-2-oxo-3-phenyl-1,8-diazaspiro[4.5]decan-8-yl]pyridine-3-carboxylate?
The IUPAC name of methyl 6-[(3R)-2-oxo-3-phenyl-1,8-diazaspiro[4.5]decan-8-yl]pyridine-3-carboxylate (CID 126434233) is methyl 6-[(3R)-2-oxo-3-phenyl-1,8-diazaspiro[4.5]decan-8-yl]pyridine-3-carboxylate.
What is the SMILES notation for methyl 6-[(3R)-2-oxo-3-phenyl-1,8-diazaspiro[4.5]decan-8-yl]pyridine-3-carboxylate?
The canonical SMILES for methyl 6-[(3R)-2-oxo-3-phenyl-1,8-diazaspiro[4.5]decan-8-yl]pyridine-3-carboxylate is COC(=O)c1ccc(N2CCC3(CC2)C[C@H](c2ccccc2)C(=O)N3)nc1.
What is the InChIKey of methyl 6-[(3R)-2-oxo-3-phenyl-1,8-diazaspiro[4.5]decan-8-yl]pyridine-3-carboxylate?
The InChIKey is HMRHPRNZNYCKNI-QGZVFWFLSA-N. The full InChI is InChI=1S/C21H23N3O3/c1-27-20(26)16-7-8-18(22-14-16)24-11-9-21(10-12-24)13-17(19(25)23-21)15-5-3-2-4-6-15/h2-8,14,17H,9-13H2,1H3,(H,23,25)/t17-/m1/s1.
What are the key properties of methyl 6-[(3R)-2-oxo-3-phenyl-1,8-diazaspiro[4.5]decan-8-yl]pyridine-3-carboxylate?
methyl 6-[(3R)-2-oxo-3-phenyl-1,8-diazaspiro[4.5]decan-8-yl]pyridine-3-carboxylate has a molecular weight of 365.43 g/mol, XLogP of 2.51, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[(3R)-2-oxo-3-phenyl-1,8-diazaspiro[4.5]decan-8-yl]pyridine-3-carboxylate is sourced from PubChem (CID 126434233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).