C16H15NO — CID 12643448
(4R,5S)-2-methyl-4,5-diphenyl-4,5-dihydro-1,3-oxazole (PubChem CID 12643448) has the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. Its IUPAC name is (4R,5S)-2-methyl-4,5-diphenyl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4R,5S)-2-methyl-4,5-diphenyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 12643448 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | (4R,5S)-2-methyl-4,5-diphenyl-4,5-dihydro-1,3-oxazole |
| SMILES | CC1=N[C@H](c2ccccc2)[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C16H15NO/c1-12-17-15(13-8-4-2-5-9-13)16(18-12)14-10-6-3-7-11-14/h2-11,15-16H,1H3/t15-,16+/m1/s1 |
| InChIKey | JTPIBZBMQLKGEE-CVEARBPZSA-N |
| XLogP | 3.92 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |