C16H23N3O2S — CID 126435010
1-methyl-3-[(3S)-1-methyl-6-oxopiperidin-3-yl]-1-(2-phenylsulfanylethyl)urea (PubChem CID 126435010) has the molecular formula C16H23N3O2S and a molecular weight of 321.45 g/mol. Its IUPAC name is 1-methyl-3-[(3S)-1-methyl-6-oxopiperidin-3-yl]-1-(2-phenylsulfanylethyl)urea.
| Compound Name | 1-methyl-3-[(3S)-1-methyl-6-oxopiperidin-3-yl]-1-(2-phenylsulfanylethyl)urea |
|---|---|
| PubChem CID | 126435010 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 1-methyl-3-[(3S)-1-methyl-6-oxopiperidin-3-yl]-1-(2-phenylsulfanylethyl)urea |
| SMILES | CN1C[C@@H](NC(=O)N(C)CCSc2ccccc2)CCC1=O |
| InChI | InChI=1S/C16H23N3O2S/c1-18(10-11-22-14-6-4-3-5-7-14)16(21)17-13-8-9-15(20)19(2)12-13/h3-7,13H,8-12H2,1-2H3,(H,17,21)/t13-/m0/s1 |
| InChIKey | CTJWJLRJLFACLI-ZDUSSCGKSA-N |
| XLogP | 2.04 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |