About N-[(1S)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methyl-2-pyrrolidin-1-ylpropanamide
N-[(1S)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methyl-2-pyrrolidin-1-ylpropanamide (PubChem CID 126435534) has the molecular formula C15H26N4O
and a molecular weight of 278.40 g/mol. Its IUPAC name is N-[(1S)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methyl-2-pyrrolidin-1-ylpropanamide.
Molecular Properties
| Compound Name | N-[(1S)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methyl-2-pyrrolidin-1-ylpropanamide |
| PubChem CID | 126435534 |
| Molecular Formula | C15H26N4O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | N-[(1S)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methyl-2-pyrrolidin-1-ylpropanamide |
| SMILES | Cc1n[nH]c(C)c1[C@H](C)NC(=O)C(C)(C)N1CCCC1 |
| InChI | InChI=1S/C15H26N4O/c1-10(13-11(2)17-18-12(13)3)16-14(20)15(4,5)19-8-6-7-9-19/h10H,6-9H2,1-5H3,(H,16,20)(H,17,18)/t10-/m0/s1 |
| InChIKey | FWEAXHOWDFIMDJ-JTQLQIEISA-N |
| XLogP | 2.08 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1S)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methyl-2-pyrrolidin-1-ylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methyl-2-pyrrolidin-1-ylpropanamide?
The IUPAC name of N-[(1S)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methyl-2-pyrrolidin-1-ylpropanamide (CID 126435534) is N-[(1S)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methyl-2-pyrrolidin-1-ylpropanamide.
What is the SMILES notation for N-[(1S)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methyl-2-pyrrolidin-1-ylpropanamide?
The canonical SMILES for N-[(1S)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methyl-2-pyrrolidin-1-ylpropanamide is Cc1n[nH]c(C)c1[C@H](C)NC(=O)C(C)(C)N1CCCC1.
What is the InChIKey of N-[(1S)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methyl-2-pyrrolidin-1-ylpropanamide?
The InChIKey is FWEAXHOWDFIMDJ-JTQLQIEISA-N. The full InChI is InChI=1S/C15H26N4O/c1-10(13-11(2)17-18-12(13)3)16-14(20)15(4,5)19-8-6-7-9-19/h10H,6-9H2,1-5H3,(H,16,20)(H,17,18)/t10-/m0/s1.
What are the key properties of N-[(1S)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methyl-2-pyrrolidin-1-ylpropanamide?
N-[(1S)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methyl-2-pyrrolidin-1-ylpropanamide has a molecular weight of 278.40 g/mol, XLogP of 2.08, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S)-1-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2-methyl-2-pyrrolidin-1-ylpropanamide is sourced from PubChem (CID 126435534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).