C15H21N5O2 — CID 126435888
7-methyl-N-[4-[(2S)-oxolan-2-yl]butyl]-[1,2,4]triazolo[4,3-a]pyrimidine-3-carboxamide (PubChem CID 126435888) has the molecular formula C15H21N5O2 and a molecular weight of 303.37 g/mol. Its IUPAC name is 7-methyl-N-[4-[(2S)-oxolan-2-yl]butyl]-[1,2,4]triazolo[4,3-a]pyrimidine-3-carboxamide.
| Compound Name | 7-methyl-N-[4-[(2S)-oxolan-2-yl]butyl]-[1,2,4]triazolo[4,3-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 126435888 |
| Molecular Formula | C15H21N5O2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 7-methyl-N-[4-[(2S)-oxolan-2-yl]butyl]-[1,2,4]triazolo[4,3-a]pyrimidine-3-carboxamide |
| SMILES | Cc1ccn2c(C(=O)NCCCC[C@H]3CCCO3)nnc2n1 |
| InChI | InChI=1S/C15H21N5O2/c1-11-7-9-20-13(18-19-15(20)17-11)14(21)16-8-3-2-5-12-6-4-10-22-12/h7,9,12H,2-6,8,10H2,1H3,(H,16,21)/t12-/m0/s1 |
| InChIKey | ARGSURHLIZRLTG-LBPRGKRZSA-N |
| XLogP | 1.51 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|