C19H33N5O — CID 126437488
N-[(2S)-5-(diethylamino)pentan-2-yl]-4-pyridin-3-ylpiperazine-1-carboxamide (PubChem CID 126437488) has the molecular formula C19H33N5O and a molecular weight of 347.51 g/mol. Its IUPAC name is N-[(2S)-5-(diethylamino)pentan-2-yl]-4-pyridin-3-ylpiperazine-1-carboxamide.
| Compound Name | N-[(2S)-5-(diethylamino)pentan-2-yl]-4-pyridin-3-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 126437488 |
| Molecular Formula | C19H33N5O |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.27 |
| IUPAC Name | N-[(2S)-5-(diethylamino)pentan-2-yl]-4-pyridin-3-ylpiperazine-1-carboxamide |
| SMILES | CCN(CC)CCC[C@H](C)NC(=O)N1CCN(c2cccnc2)CC1 |
| InChI | InChI=1S/C19H33N5O/c1-4-22(5-2)11-7-8-17(3)21-19(25)24-14-12-23(13-15-24)18-9-6-10-20-16-18/h6,9-10,16-17H,4-5,7-8,11-15H2,1-3H3,(H,21,25)/t17-/m0/s1 |
| InChIKey | MYDSVBFXIRASFD-KRWDZBQOSA-N |
| XLogP | 2.42 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |