C13H20N2O5 — CID 126438913
2-[4-[2-[(3R)-oxan-3-yl]acetyl]-2-oxopiperazin-1-yl]acetic acid (PubChem CID 126438913) has the molecular formula C13H20N2O5 and a molecular weight of 284.31 g/mol. Its IUPAC name is 2-[4-[2-[(3R)-oxan-3-yl]acetyl]-2-oxopiperazin-1-yl]acetic acid.
| Compound Name | 2-[4-[2-[(3R)-oxan-3-yl]acetyl]-2-oxopiperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 126438913 |
| Molecular Formula | C13H20N2O5 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 2-[4-[2-[(3R)-oxan-3-yl]acetyl]-2-oxopiperazin-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(C(=O)C[C@H]2CCCOC2)CC1=O |
| InChI | InChI=1S/C13H20N2O5/c16-11(6-10-2-1-5-20-9-10)14-3-4-15(8-13(18)19)12(17)7-14/h10H,1-9H2,(H,18,19)/t10-/m1/s1 |
| InChIKey | FAZWWRBYOPIQBZ-SNVBAGLBSA-N |
| XLogP | -0.44 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |