C12H13N5O — CID 126439244
4-cyano-N-[(1R)-1-(5-methyl-1H-imidazol-2-yl)ethyl]-1H-pyrrole-2-carboxamide (PubChem CID 126439244) has the molecular formula C12H13N5O and a molecular weight of 243.27 g/mol. Its IUPAC name is 4-cyano-N-[(1R)-1-(5-methyl-1H-imidazol-2-yl)ethyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-cyano-N-[(1R)-1-(5-methyl-1H-imidazol-2-yl)ethyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 126439244 |
| Molecular Formula | C12H13N5O |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 4-cyano-N-[(1R)-1-(5-methyl-1H-imidazol-2-yl)ethyl]-1H-pyrrole-2-carboxamide |
| SMILES | Cc1cnc([C@@H](C)NC(=O)c2cc(C#N)c[nH]2)[nH]1 |
| InChI | InChI=1S/C12H13N5O/c1-7-5-15-11(16-7)8(2)17-12(18)10-3-9(4-13)6-14-10/h3,5-6,8,14H,1-2H3,(H,15,16)(H,17,18)/t8-/m1/s1 |
| InChIKey | PQXLIHQJWSKLLQ-MRVPVSSYSA-N |
| XLogP | 1.41 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |