C16H22N4O2 — CID 126439318
1-[(3S)-3-hydroxy-3-phenylpropyl]-1-methyl-3-[(5-methyl-1H-pyrazol-3-yl)methyl]urea (PubChem CID 126439318) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 1-[(3S)-3-hydroxy-3-phenylpropyl]-1-methyl-3-[(5-methyl-1H-pyrazol-3-yl)methyl]urea.
| Compound Name | 1-[(3S)-3-hydroxy-3-phenylpropyl]-1-methyl-3-[(5-methyl-1H-pyrazol-3-yl)methyl]urea |
|---|---|
| PubChem CID | 126439318 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 1-[(3S)-3-hydroxy-3-phenylpropyl]-1-methyl-3-[(5-methyl-1H-pyrazol-3-yl)methyl]urea |
| SMILES | Cc1cc(CNC(=O)N(C)CC[C@H](O)c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C16H22N4O2/c1-12-10-14(19-18-12)11-17-16(22)20(2)9-8-15(21)13-6-4-3-5-7-13/h3-7,10,15,21H,8-9,11H2,1-2H3,(H,17,22)(H,18,19)/t15-/m0/s1 |
| InChIKey | GVRROPMZJBSLMG-HNNXBMFYSA-N |
| XLogP | 1.98 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |