C13H20N8OS — CID 126441556
(3R)-3-(5-methyl-1H-1,2,4-triazol-3-yl)-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]piperidine-1-carboxamide (PubChem CID 126441556) has the molecular formula C13H20N8OS and a molecular weight of 336.43 g/mol. Its IUPAC name is (3R)-3-(5-methyl-1H-1,2,4-triazol-3-yl)-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]piperidine-1-carboxamide.
| Compound Name | (3R)-3-(5-methyl-1H-1,2,4-triazol-3-yl)-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 126441556 |
| Molecular Formula | C13H20N8OS |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (3R)-3-(5-methyl-1H-1,2,4-triazol-3-yl)-N-[2-(2H-triazol-4-ylsulfanyl)ethyl]piperidine-1-carboxamide |
| SMILES | Cc1nc([C@@H]2CCCN(C(=O)NCCSc3cn[nH]n3)C2)n[nH]1 |
| InChI | InChI=1S/C13H20N8OS/c1-9-16-12(19-17-9)10-3-2-5-21(8-10)13(22)14-4-6-23-11-7-15-20-18-11/h7,10H,2-6,8H2,1H3,(H,14,22)(H,15,18,20)(H,16,17,19)/t10-/m1/s1 |
| InChIKey | KMSWRJHPFWUSRX-SNVBAGLBSA-N |
| XLogP | 0.91 |
| TPSA | 115.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|