About Lithium bicyclo[2.2.1]hepta-2,5-dien-7-ide
Lithium bicyclo[2.2.1]hepta-2,5-dien-7-ide (PubChem CID 12644165) has the molecular formula C7H7Li
and a molecular weight of 98.07 g/mol.
Molecular Properties
| Compound Name | Lithium bicyclo[2.2.1]hepta-2,5-dien-7-ide |
| PubChem CID | 12644165 |
| Molecular Formula | C7H7Li |
| Molecular Weight | 98.07 g/mol |
| Exact Mass | 98.07 |
| IUPAC Name | — |
| SMILES | C1=CC2C=CC1[CH-]2.[Li+] |
| InChI | InChI=1S/C7H7.Li/c1-2-7-4-3-6(1)5-7;/h1-7H;/q-1;+1 |
| InChIKey | PTWAQJCAVMXCQH-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.07 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze Lithium bicyclo[2.2.1]hepta-2,5-dien-7-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Lithium bicyclo[2.2.1]hepta-2,5-dien-7-ide?
The IUPAC name of Lithium bicyclo[2.2.1]hepta-2,5-dien-7-ide (CID 12644165) is not available.
What is the SMILES notation for Lithium bicyclo[2.2.1]hepta-2,5-dien-7-ide?
The canonical SMILES for Lithium bicyclo[2.2.1]hepta-2,5-dien-7-ide is C1=CC2C=CC1[CH-]2.[Li+].
What is the InChIKey of Lithium bicyclo[2.2.1]hepta-2,5-dien-7-ide?
The InChIKey is PTWAQJCAVMXCQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7.Li/c1-2-7-4-3-6(1)5-7;/h1-7H;/q-1;+1.
What are the key properties of Lithium bicyclo[2.2.1]hepta-2,5-dien-7-ide?
Lithium bicyclo[2.2.1]hepta-2,5-dien-7-ide has a molecular weight of 98.07 g/mol, XLogP of -1.43, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Lithium bicyclo[2.2.1]hepta-2,5-dien-7-ide is sourced from PubChem (CID 12644165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).