C15H18N6O3S — CID 126442455
1-[(2R)-2,4-dimethyl-3-oxo-1,4-benzoxazin-6-yl]-3-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]urea (PubChem CID 126442455) has the molecular formula C15H18N6O3S and a molecular weight of 362.42 g/mol. Its IUPAC name is 1-[(2R)-2,4-dimethyl-3-oxo-1,4-benzoxazin-6-yl]-3-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]urea.
| Compound Name | 1-[(2R)-2,4-dimethyl-3-oxo-1,4-benzoxazin-6-yl]-3-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]urea |
|---|---|
| PubChem CID | 126442455 |
| Molecular Formula | C15H18N6O3S |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 1-[(2R)-2,4-dimethyl-3-oxo-1,4-benzoxazin-6-yl]-3-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]urea |
| SMILES | C[C@H]1Oc2ccc(NC(=O)NCCSc3ncn[nH]3)cc2N(C)C1=O |
| InChI | InChI=1S/C15H18N6O3S/c1-9-13(22)21(2)11-7-10(3-4-12(11)24-9)19-14(23)16-5-6-25-15-17-8-18-20-15/h3-4,7-9H,5-6H2,1-2H3,(H2,16,19,23)(H,17,18,20)/t9-/m1/s1 |
| InChIKey | XVKBRNRUXVSPDV-SECBINFHSA-N |
| XLogP | 1.46 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|