C20H22N6O2 — CID 126442521
3-(4-methoxyphenyl)-N-[(3S)-1-pyrazin-2-ylpiperidin-3-yl]-1H-pyrazole-5-carboxamide (PubChem CID 126442521) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-N-[(3S)-1-pyrazin-2-ylpiperidin-3-yl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(4-methoxyphenyl)-N-[(3S)-1-pyrazin-2-ylpiperidin-3-yl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 126442521 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 3-(4-methoxyphenyl)-N-[(3S)-1-pyrazin-2-ylpiperidin-3-yl]-1H-pyrazole-5-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)N[C@H]3CCCN(c4cnccn4)C3)[nH]n2)cc1 |
| InChI | InChI=1S/C20H22N6O2/c1-28-16-6-4-14(5-7-16)17-11-18(25-24-17)20(27)23-15-3-2-10-26(13-15)19-12-21-8-9-22-19/h4-9,11-12,15H,2-3,10,13H2,1H3,(H,23,27)(H,24,25)/t15-/m0/s1 |
| InChIKey | OCOYKMLHXHFAHZ-HNNXBMFYSA-N |
| XLogP | 2.27 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |