C20H26N4O3 — CID 126442787
2-[4-[2-(methoxymethyl)-6-[(3S)-oxolan-3-yl]pyrimidin-4-yl]piperazin-1-yl]phenol (PubChem CID 126442787) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-[4-[2-(methoxymethyl)-6-[(3S)-oxolan-3-yl]pyrimidin-4-yl]piperazin-1-yl]phenol.
| Compound Name | 2-[4-[2-(methoxymethyl)-6-[(3S)-oxolan-3-yl]pyrimidin-4-yl]piperazin-1-yl]phenol |
|---|---|
| PubChem CID | 126442787 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 2-[4-[2-(methoxymethyl)-6-[(3S)-oxolan-3-yl]pyrimidin-4-yl]piperazin-1-yl]phenol |
| SMILES | COCc1nc([C@@H]2CCOC2)cc(N2CCN(c3ccccc3O)CC2)n1 |
| InChI | InChI=1S/C20H26N4O3/c1-26-14-19-21-16(15-6-11-27-13-15)12-20(22-19)24-9-7-23(8-10-24)17-4-2-3-5-18(17)25/h2-5,12,15,25H,6-11,13-14H2,1H3/t15-/m1/s1 |
| InChIKey | OOJZUEPMSIWZAW-OAHLLOKOSA-N |
| XLogP | 2.16 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |