C19H28N2O3 — CID 126443915
(2S)-N,2-dimethyl-N-(4-morpholin-4-ylbutyl)-2,3-dihydro-1-benzofuran-5-carboxamide (PubChem CID 126443915) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is (2S)-N,2-dimethyl-N-(4-morpholin-4-ylbutyl)-2,3-dihydro-1-benzofuran-5-carboxamide.
| Compound Name | (2S)-N,2-dimethyl-N-(4-morpholin-4-ylbutyl)-2,3-dihydro-1-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 126443915 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | (2S)-N,2-dimethyl-N-(4-morpholin-4-ylbutyl)-2,3-dihydro-1-benzofuran-5-carboxamide |
| SMILES | C[C@H]1Cc2cc(C(=O)N(C)CCCCN3CCOCC3)ccc2O1 |
| InChI | InChI=1S/C19H28N2O3/c1-15-13-17-14-16(5-6-18(17)24-15)19(22)20(2)7-3-4-8-21-9-11-23-12-10-21/h5-6,14-15H,3-4,7-13H2,1-2H3/t15-/m0/s1 |
| InChIKey | CYKUVYMURLDKMX-HNNXBMFYSA-N |
| XLogP | 2.19 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|