About 4,6-dimethyl-2-phenyl-1,2-dihydropyrimidine
4,6-dimethyl-2-phenyl-1,2-dihydropyrimidine (PubChem CID 12644471) has the molecular formula C12H14N2
and a molecular weight of 186.26 g/mol. Its IUPAC name is 4,6-dimethyl-2-phenyl-1,2-dihydropyrimidine.
Molecular Properties
| Compound Name | 4,6-dimethyl-2-phenyl-1,2-dihydropyrimidine |
| PubChem CID | 12644471 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 4,6-dimethyl-2-phenyl-1,2-dihydropyrimidine |
| SMILES | CC1=CC(C)=NC(c2ccccc2)N1 |
| InChI | InChI=1S/C12H14N2/c1-9-8-10(2)14-12(13-9)11-6-4-3-5-7-11/h3-8,12-13H,1-2H3 |
| InChIKey | ICXKQIPBQFMNBU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,6-dimethyl-2-phenyl-1,2-dihydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethyl-2-phenyl-1,2-dihydropyrimidine?
The IUPAC name of 4,6-dimethyl-2-phenyl-1,2-dihydropyrimidine (CID 12644471) is 4,6-dimethyl-2-phenyl-1,2-dihydropyrimidine.
What is the SMILES notation for 4,6-dimethyl-2-phenyl-1,2-dihydropyrimidine?
The canonical SMILES for 4,6-dimethyl-2-phenyl-1,2-dihydropyrimidine is CC1=CC(C)=NC(c2ccccc2)N1.
What is the InChIKey of 4,6-dimethyl-2-phenyl-1,2-dihydropyrimidine?
The InChIKey is ICXKQIPBQFMNBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2/c1-9-8-10(2)14-12(13-9)11-6-4-3-5-7-11/h3-8,12-13H,1-2H3.
What are the key properties of 4,6-dimethyl-2-phenyl-1,2-dihydropyrimidine?
4,6-dimethyl-2-phenyl-1,2-dihydropyrimidine has a molecular weight of 186.26 g/mol, XLogP of 2.65, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethyl-2-phenyl-1,2-dihydropyrimidine is sourced from PubChem (CID 12644471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).