About 1-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)-3-[(1S)-1-(6-methyl-3-pyridinyl)ethyl]urea
1-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)-3-[(1S)-1-(6-methyl-3-pyridinyl)ethyl]urea (PubChem CID 126446112) has the molecular formula C19H22N4O3
and a molecular weight of 354.41 g/mol. Its IUPAC name is 1-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)-3-[(1S)-1-(6-methyl-3-pyridinyl)ethyl]urea.
Molecular Properties
| Compound Name | 1-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)-3-[(1S)-1-(6-methyl-3-pyridinyl)ethyl]urea |
| PubChem CID | 126446112 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 1-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)-3-[(1S)-1-(6-methyl-3-pyridinyl)ethyl]urea |
| SMILES | CCN1C(=O)COc2ccc(NC(=O)N[C@@H](C)c3ccc(C)nc3)cc21 |
| InChI | InChI=1S/C19H22N4O3/c1-4-23-16-9-15(7-8-17(16)26-11-18(23)24)22-19(25)21-13(3)14-6-5-12(2)20-10-14/h5-10,13H,4,11H2,1-3H3,(H2,21,22,25)/t13-/m0/s1 |
| InChIKey | HONRYRGSDQSQEX-ZDUSSCGKSA-N |
| XLogP | 3.02 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)-3-[(1S)-1-(6-methyl-3-pyridinyl)ethyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)-3-[(1S)-1-(6-methyl-3-pyridinyl)ethyl]urea?
The IUPAC name of 1-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)-3-[(1S)-1-(6-methyl-3-pyridinyl)ethyl]urea (CID 126446112) is 1-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)-3-[(1S)-1-(6-methyl-3-pyridinyl)ethyl]urea.
What is the SMILES notation for 1-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)-3-[(1S)-1-(6-methyl-3-pyridinyl)ethyl]urea?
The canonical SMILES for 1-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)-3-[(1S)-1-(6-methyl-3-pyridinyl)ethyl]urea is CCN1C(=O)COc2ccc(NC(=O)N[C@@H](C)c3ccc(C)nc3)cc21.
What is the InChIKey of 1-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)-3-[(1S)-1-(6-methyl-3-pyridinyl)ethyl]urea?
The InChIKey is HONRYRGSDQSQEX-ZDUSSCGKSA-N. The full InChI is InChI=1S/C19H22N4O3/c1-4-23-16-9-15(7-8-17(16)26-11-18(23)24)22-19(25)21-13(3)14-6-5-12(2)20-10-14/h5-10,13H,4,11H2,1-3H3,(H2,21,22,25)/t13-/m0/s1.
What are the key properties of 1-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)-3-[(1S)-1-(6-methyl-3-pyridinyl)ethyl]urea?
1-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)-3-[(1S)-1-(6-methyl-3-pyridinyl)ethyl]urea has a molecular weight of 354.41 g/mol, XLogP of 3.02, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)-3-[(1S)-1-(6-methyl-3-pyridinyl)ethyl]urea is sourced from PubChem (CID 126446112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).