About 5-[(4R)-3,3-dimethyl-4-phenylpyrrolidin-1-yl]sulfonyl-1-propylpyrazole
5-[(4R)-3,3-dimethyl-4-phenylpyrrolidin-1-yl]sulfonyl-1-propylpyrazole (PubChem CID 126447347) has the molecular formula C18H25N3O2S
and a molecular weight of 347.48 g/mol. Its IUPAC name is 5-[(4R)-3,3-dimethyl-4-phenylpyrrolidin-1-yl]sulfonyl-1-propylpyrazole.
Molecular Properties
| Compound Name | 5-[(4R)-3,3-dimethyl-4-phenylpyrrolidin-1-yl]sulfonyl-1-propylpyrazole |
| PubChem CID | 126447347 |
| Molecular Formula | C18H25N3O2S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 5-[(4R)-3,3-dimethyl-4-phenylpyrrolidin-1-yl]sulfonyl-1-propylpyrazole |
| SMILES | CCCn1nccc1S(=O)(=O)N1C[C@H](c2ccccc2)C(C)(C)C1 |
| InChI | InChI=1S/C18H25N3O2S/c1-4-12-21-17(10-11-19-21)24(22,23)20-13-16(18(2,3)14-20)15-8-6-5-7-9-15/h5-11,16H,4,12-14H2,1-3H3/t16-/m1/s1 |
| InChIKey | QYRJCLDXGTUNLM-MRXNPFEDSA-N |
| XLogP | 3.11 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(4R)-3,3-dimethyl-4-phenylpyrrolidin-1-yl]sulfonyl-1-propylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4R)-3,3-dimethyl-4-phenylpyrrolidin-1-yl]sulfonyl-1-propylpyrazole?
The IUPAC name of 5-[(4R)-3,3-dimethyl-4-phenylpyrrolidin-1-yl]sulfonyl-1-propylpyrazole (CID 126447347) is 5-[(4R)-3,3-dimethyl-4-phenylpyrrolidin-1-yl]sulfonyl-1-propylpyrazole.
What is the SMILES notation for 5-[(4R)-3,3-dimethyl-4-phenylpyrrolidin-1-yl]sulfonyl-1-propylpyrazole?
The canonical SMILES for 5-[(4R)-3,3-dimethyl-4-phenylpyrrolidin-1-yl]sulfonyl-1-propylpyrazole is CCCn1nccc1S(=O)(=O)N1C[C@H](c2ccccc2)C(C)(C)C1.
What is the InChIKey of 5-[(4R)-3,3-dimethyl-4-phenylpyrrolidin-1-yl]sulfonyl-1-propylpyrazole?
The InChIKey is QYRJCLDXGTUNLM-MRXNPFEDSA-N. The full InChI is InChI=1S/C18H25N3O2S/c1-4-12-21-17(10-11-19-21)24(22,23)20-13-16(18(2,3)14-20)15-8-6-5-7-9-15/h5-11,16H,4,12-14H2,1-3H3/t16-/m1/s1.
What are the key properties of 5-[(4R)-3,3-dimethyl-4-phenylpyrrolidin-1-yl]sulfonyl-1-propylpyrazole?
5-[(4R)-3,3-dimethyl-4-phenylpyrrolidin-1-yl]sulfonyl-1-propylpyrazole has a molecular weight of 347.48 g/mol, XLogP of 3.11, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4R)-3,3-dimethyl-4-phenylpyrrolidin-1-yl]sulfonyl-1-propylpyrazole is sourced from PubChem (CID 126447347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).