C14H18N2O — CID 126448059
4-[3-[(1S)-1-methoxyethyl]phenyl]-2,5-dimethyl-1H-imidazole (PubChem CID 126448059) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 4-[3-[(1S)-1-methoxyethyl]phenyl]-2,5-dimethyl-1H-imidazole.
| Compound Name | 4-[3-[(1S)-1-methoxyethyl]phenyl]-2,5-dimethyl-1H-imidazole |
|---|---|
| PubChem CID | 126448059 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 4-[3-[(1S)-1-methoxyethyl]phenyl]-2,5-dimethyl-1H-imidazole |
| SMILES | CO[C@@H](C)c1cccc(-c2nc(C)[nH]c2C)c1 |
| InChI | InChI=1S/C14H18N2O/c1-9-14(16-11(3)15-9)13-7-5-6-12(8-13)10(2)17-4/h5-8,10H,1-4H3,(H,15,16)/t10-/m0/s1 |
| InChIKey | VKJJRYQURGAURR-JTQLQIEISA-N |
| XLogP | 3.40 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |