C19H30N4O3 — CID 126448398
2-[1-[[(2S)-2-(2-pyrazol-1-ylethyl)piperidine-1-carbonyl]amino]cyclohexyl]acetic acid (PubChem CID 126448398) has the molecular formula C19H30N4O3 and a molecular weight of 362.47 g/mol. Its IUPAC name is 2-[1-[[(2S)-2-(2-pyrazol-1-ylethyl)piperidine-1-carbonyl]amino]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[[(2S)-2-(2-pyrazol-1-ylethyl)piperidine-1-carbonyl]amino]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 126448398 |
| Molecular Formula | C19H30N4O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | 2-[1-[[(2S)-2-(2-pyrazol-1-ylethyl)piperidine-1-carbonyl]amino]cyclohexyl]acetic acid |
| SMILES | O=C(O)CC1(NC(=O)N2CCCC[C@H]2CCn2cccn2)CCCCC1 |
| InChI | InChI=1S/C19H30N4O3/c24-17(25)15-19(9-3-1-4-10-19)21-18(26)23-13-5-2-7-16(23)8-14-22-12-6-11-20-22/h6,11-12,16H,1-5,7-10,13-15H2,(H,21,26)(H,24,25)/t16-/m0/s1 |
| InChIKey | XEEPDUAATKNIGL-INIZCTEOSA-N |
| XLogP | 3.01 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |