C20H31N3O3 — CID 126448550
4-[(3-methoxyphenyl)methyl]-N-[2-[(2R)-oxan-2-yl]ethyl]piperazine-1-carboxamide (PubChem CID 126448550) has the molecular formula C20H31N3O3 and a molecular weight of 361.49 g/mol. Its IUPAC name is 4-[(3-methoxyphenyl)methyl]-N-[2-[(2R)-oxan-2-yl]ethyl]piperazine-1-carboxamide.
| Compound Name | 4-[(3-methoxyphenyl)methyl]-N-[2-[(2R)-oxan-2-yl]ethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 126448550 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | 4-[(3-methoxyphenyl)methyl]-N-[2-[(2R)-oxan-2-yl]ethyl]piperazine-1-carboxamide |
| SMILES | COc1cccc(CN2CCN(C(=O)NCC[C@H]3CCCCO3)CC2)c1 |
| InChI | InChI=1S/C20H31N3O3/c1-25-19-7-4-5-17(15-19)16-22-10-12-23(13-11-22)20(24)21-9-8-18-6-2-3-14-26-18/h4-5,7,15,18H,2-3,6,8-14,16H2,1H3,(H,21,24)/t18-/m1/s1 |
| InChIKey | NUXMXCWZWVTHSE-GOSISDBHSA-N |
| XLogP | 2.48 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |