C19H25N3O5 — CID 126448599
2-[(5R)-7-[(2,3-dimethoxyphenyl)methyl]-6-oxo-2,7-diazaspiro[4.5]decan-2-yl]-2-oxoacetamide (PubChem CID 126448599) has the molecular formula C19H25N3O5 and a molecular weight of 375.43 g/mol. Its IUPAC name is 2-[(5R)-7-[(2,3-dimethoxyphenyl)methyl]-6-oxo-2,7-diazaspiro[4.5]decan-2-yl]-2-oxoacetamide.
| Compound Name | 2-[(5R)-7-[(2,3-dimethoxyphenyl)methyl]-6-oxo-2,7-diazaspiro[4.5]decan-2-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 126448599 |
| Molecular Formula | C19H25N3O5 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 2-[(5R)-7-[(2,3-dimethoxyphenyl)methyl]-6-oxo-2,7-diazaspiro[4.5]decan-2-yl]-2-oxoacetamide |
| SMILES | COc1cccc(CN2CCC[C@]3(CCN(C(=O)C(N)=O)C3)C2=O)c1OC |
| InChI | InChI=1S/C19H25N3O5/c1-26-14-6-3-5-13(15(14)27-2)11-21-9-4-7-19(18(21)25)8-10-22(12-19)17(24)16(20)23/h3,5-6H,4,7-12H2,1-2H3,(H2,20,23)/t19-/m1/s1 |
| InChIKey | ZYWVZGHGGSWDMA-LJQANCHMSA-N |
| XLogP | 0.53 |
| TPSA | 102.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|